C25H33ClO13 — CID 101021464
methyl (1S,4aS,6S,7R,7aS)-6-acetyloxy-7-methyl-1-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-(chloromethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 101021464) has the molecular formula C25H33ClO13 and a molecular weight of 576.98 g/mol. Its IUPAC name is methyl (1S,4aS,6S,7R,7aS)-6-acetyloxy-7-methyl-1-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-(chloromethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1S,4aS,6S,7R,7aS)-6-acetyloxy-7-methyl-1-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-(chloromethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 101021464 |
| Molecular Formula | C25H33ClO13 |
| Molecular Weight | 576.98 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | methyl (1S,4aS,6S,7R,7aS)-6-acetyloxy-7-methyl-1-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-(chloromethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CCl)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@@H]2[C@@H](C)[C@@H](OC(C)=O)C[C@H]12 |
| InChI | InChI=1S/C25H33ClO13/c1-10-17(34-11(2)27)7-15-16(23(31)32-6)9-33-24(19(10)15)39-25-22(37-14(5)30)21(36-13(4)29)20(35-12(3)28)18(8-26)38-25/h9-10,15,17-22,24-25H,7-8H2,1-6H3/t10-,15+,17-,18+,19+,20+,21-,22+,24-,25-/m0/s1 |
| InChIKey | FMSXRALAESDBJH-UCMDCWNLSA-N |
| XLogP | 1.38 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.98 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|