C33H31N2O5PS — CID 10555513
(2S)-2-[[(2R)-3-diphenylphosphinothioyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid (PubChem CID 10555513) has the molecular formula C33H31N2O5PS and a molecular weight of 598.66 g/mol. Its IUPAC name is (2S)-2-[[(2R)-3-diphenylphosphinothioyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2R)-3-diphenylphosphinothioyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10555513 |
| Molecular Formula | C33H31N2O5PS |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | (2S)-2-[[(2R)-3-diphenylphosphinothioyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](CP(=S)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C33H31N2O5PS/c1-22(32(37)38)34-31(36)30(21-41(42,23-12-4-2-5-13-23)24-14-6-3-7-15-24)35-33(39)40-20-29-27-18-10-8-16-25(27)26-17-9-11-19-28(26)29/h2-19,22,29-30H,20-21H2,1H3,(H,34,36)(H,35,39)(H,37,38)/t22-,30-/m0/s1 |
| InChIKey | BLOKQNGPIQVXGK-CHJDUVSTSA-N |
| XLogP | 4.61 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|