C39H39NO6 — CID 10555825
[(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-(1,3-benzodioxol-5-ylmethyl)-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate (PubChem CID 10555825) has the molecular formula C39H39NO6 and a molecular weight of 617.74 g/mol. Its IUPAC name is [(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-(1,3-benzodioxol-5-ylmethyl)-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate.
| Compound Name | [(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-(1,3-benzodioxol-5-ylmethyl)-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate |
|---|---|
| PubChem CID | 10555825 |
| Molecular Formula | C39H39NO6 |
| Molecular Weight | 617.74 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | [(1R,2S,3S,4R)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-(1,3-benzodioxol-5-ylmethyl)-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate |
| SMILES | COc1ccc(N2C(=O)C(C(=O)O[C@H]3[C@@H]4CC[C@](C)([C@H]3c3cccc5ccccc35)C4(C)C)C2Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C39H39NO6/c1-38(2)29-18-19-39(38,3)34(28-11-7-9-24-8-5-6-10-27(24)28)35(29)46-37(42)33-30(20-23-12-17-31-32(21-23)45-22-44-31)40(36(33)41)25-13-15-26(43-4)16-14-25/h5-17,21,29-30,33-35H,18-20,22H2,1-4H3/t29-,30?,33?,34-,35-,39+/m0/s1 |
| InChIKey | ZZRBIHVGUCAQIJ-ASKGWHAZSA-N |
| XLogP | 7.30 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.74 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|