C39H41NO6 — CID 10555847
[(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 3-[N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-methoxyanilino]-3-oxopropanoate (PubChem CID 10555847) has the molecular formula C39H41NO6 and a molecular weight of 619.76 g/mol. Its IUPAC name is [(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 3-[N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-methoxyanilino]-3-oxopropanoate.
| Compound Name | [(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 3-[N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-methoxyanilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 10555847 |
| Molecular Formula | C39H41NO6 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | [(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 3-[N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-methoxyanilino]-3-oxopropanoate |
| SMILES | COc1ccc(N(CCc2ccc3c(c2)OCO3)C(=O)CC(=O)O[C@H]2[C@@H]3CC[C@](C)([C@H]2c2ccc4ccccc4c2)C3(C)C)cc1 |
| InChI | InChI=1S/C39H41NO6/c1-38(2)31-17-19-39(38,3)36(28-11-10-26-7-5-6-8-27(26)22-28)37(31)46-35(42)23-34(41)40(29-12-14-30(43-4)15-13-29)20-18-25-9-16-32-33(21-25)45-24-44-32/h5-16,21-22,31,36-37H,17-20,23-24H2,1-4H3/t31-,36-,37-,39+/m0/s1 |
| InChIKey | VOYPPXQQIBEOFE-PWTSDHCZSA-N |
| XLogP | 7.69 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|