C33H39NO4 — CID 10601880
[(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 3-(4-methoxy-N-propylanilino)-3-oxopropanoate (PubChem CID 10601880) has the molecular formula C33H39NO4 and a molecular weight of 513.68 g/mol. Its IUPAC name is [(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 3-(4-methoxy-N-propylanilino)-3-oxopropanoate.
| Compound Name | [(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 3-(4-methoxy-N-propylanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 10601880 |
| Molecular Formula | C33H39NO4 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | [(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl] 3-(4-methoxy-N-propylanilino)-3-oxopropanoate |
| SMILES | CCCN(C(=O)CC(=O)O[C@H]1[C@@H]2CC[C@](C)([C@H]1c1ccc3ccccc3c1)C2(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H39NO4/c1-6-19-34(25-13-15-26(37-5)16-14-25)28(35)21-29(36)38-31-27-17-18-33(4,32(27,2)3)30(31)24-12-11-22-9-7-8-10-23(22)20-24/h7-16,20,27,30-31H,6,17-19,21H2,1-5H3/t27-,30-,31-,33+/m0/s1 |
| InChIKey | NTXAWPOLTQFJSA-GVPIEBCOSA-N |
| XLogP | 7.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|