C33H38N3O4+ — CID 10697698
(Z)-1-hydroxy-3-(4-methoxy-N-propylanilino)-3-oxo-1-[[(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl]oxy]prop-1-ene-2-diazonium (PubChem CID 10697698) has the molecular formula C33H38N3O4+ and a molecular weight of 540.68 g/mol. Its IUPAC name is (Z)-1-hydroxy-3-(4-methoxy-N-propylanilino)-3-oxo-1-[[(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl]oxy]prop-1-ene-2-diazonium.
| Compound Name | (Z)-1-hydroxy-3-(4-methoxy-N-propylanilino)-3-oxo-1-[[(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl]oxy]prop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 10697698 |
| Molecular Formula | C33H38N3O4+ |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | (Z)-1-hydroxy-3-(4-methoxy-N-propylanilino)-3-oxo-1-[[(1R,2S,3R,4R)-4,7,7-trimethyl-3-naphthalen-2-yl-2-bicyclo[2.2.1]heptanyl]oxy]prop-1-ene-2-diazonium |
| SMILES | CCCN(C(=O)/C([N+]#N)=C(\O)O[C@H]1[C@@H]2CC[C@](C)([C@H]1c1ccc3ccccc3c1)C2(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H37N3O4/c1-6-19-36(24-13-15-25(39-5)16-14-24)30(37)28(35-34)31(38)40-29-26-17-18-33(4,32(26,2)3)27(29)23-12-11-21-9-7-8-10-22(21)20-23/h7-16,20,26-27,29H,6,17-19H2,1-5H3/p+1/t26-,27-,29-,33+/m0/s1 |
| InChIKey | PHNGBZHAQLDDOY-POCMPZBTSA-O |
| XLogP | 7.80 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|