C36H43N3O4 — CID 102122073
[(1R,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-(N-hexyl-4-methoxyanilino)-3-oxopropanoate (PubChem CID 102122073) has the molecular formula C36H43N3O4 and a molecular weight of 581.76 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-(N-hexyl-4-methoxyanilino)-3-oxopropanoate.
| Compound Name | [(1R,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-(N-hexyl-4-methoxyanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 102122073 |
| Molecular Formula | C36H43N3O4 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | [(1R,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-diazo-3-(N-hexyl-4-methoxyanilino)-3-oxopropanoate |
| SMILES | CCCCCCN(C(=O)C(=[N+]=[N-])C(=O)O[C@H]1[C@@H](c2cccc3ccccc23)[C@]2(C)CC[C@@H]1C2(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C36H43N3O4/c1-6-7-8-11-23-39(25-17-19-26(42-5)20-18-25)33(40)31(38-37)34(41)43-32-29-21-22-36(4,35(29,2)3)30(32)28-16-12-14-24-13-9-10-15-27(24)28/h9-10,12-20,29-30,32H,6-8,11,21-23H2,1-5H3/t29-,30+,32+,36-/m0/s1 |
| InChIKey | JSHKVTFVGCEJIY-SJZBRESZSA-N |
| XLogP | 7.58 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|