C38H45NO4 — CID 11071961
[(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-(cyclohexylmethyl)-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate (PubChem CID 11071961) has the molecular formula C38H45NO4 and a molecular weight of 579.78 g/mol. Its IUPAC name is [(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-(cyclohexylmethyl)-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate.
| Compound Name | [(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-(cyclohexylmethyl)-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate |
|---|---|
| PubChem CID | 11071961 |
| Molecular Formula | C38H45NO4 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | [(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 2-(cyclohexylmethyl)-1-(4-methoxyphenyl)-4-oxoazetidine-3-carboxylate |
| SMILES | COc1ccc(N2C(=O)C(C(=O)O[C@@H]3[C@H]4CC[C@@](C)([C@@H]3c3cccc5ccccc35)C4(C)C)C2CC2CCCCC2)cc1 |
| InChI | InChI=1S/C38H45NO4/c1-37(2)30-21-22-38(37,3)33(29-16-10-14-25-13-8-9-15-28(25)29)34(30)43-36(41)32-31(23-24-11-6-5-7-12-24)39(35(32)40)26-17-19-27(42-4)20-18-26/h8-10,13-20,24,30-34H,5-7,11-12,21-23H2,1-4H3/t30-,31?,32?,33-,34-,38+/m1/s1 |
| InChIKey | KUKRSMONMOLNNW-XCBYJJDRSA-N |
| XLogP | 8.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|