C33H37NO4 — CID 10720529
[(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 1-(4-methoxyphenyl)-4-methyl-2-oxopyrrolidine-3-carboxylate (PubChem CID 10720529) has the molecular formula C33H37NO4 and a molecular weight of 511.66 g/mol. Its IUPAC name is [(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 1-(4-methoxyphenyl)-4-methyl-2-oxopyrrolidine-3-carboxylate.
| Compound Name | [(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 1-(4-methoxyphenyl)-4-methyl-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 10720529 |
| Molecular Formula | C33H37NO4 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | [(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] 1-(4-methoxyphenyl)-4-methyl-2-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccc(N2CC(C)C(C(=O)O[C@@H]3[C@H]4CC[C@@](C)([C@@H]3c3cccc5ccccc35)C4(C)C)C2=O)cc1 |
| InChI | InChI=1S/C33H37NO4/c1-20-19-34(22-13-15-23(37-5)16-14-22)30(35)27(20)31(36)38-29-26-17-18-33(4,32(26,2)3)28(29)25-12-8-10-21-9-6-7-11-24(21)25/h6-16,20,26-29H,17-19H2,1-5H3/t20?,26-,27?,28-,29-,33+/m1/s1 |
| InChIKey | JLSBPTITDLPZIR-OUHIHPTISA-N |
| XLogP | 6.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|