C11H10N4 — CID 10559868
1-methylimidazo[1,2-a]quinoxalin-4-amine (PubChem CID 10559868) has the molecular formula C11H10N4 and a molecular weight of 198.23 g/mol. Its IUPAC name is 1-methylimidazo[1,2-a]quinoxalin-4-amine.
| Compound Name | 1-methylimidazo[1,2-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 10559868 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-methylimidazo[1,2-a]quinoxalin-4-amine |
| SMILES | Cc1cnc2c(N)nc3ccccc3n12 |
| InChI | InChI=1S/C11H10N4/c1-7-6-13-11-10(12)14-8-4-2-3-5-9(8)15(7)11/h2-6H,1H3,(H2,12,14) |
| InChIKey | MWIBZYOIUYMZSJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |