C15H12N4 — CID 122523474
8,9-dimethyl-1,3,4,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,8,10,12,14,16-octaene (PubChem CID 122523474) has the molecular formula C15H12N4 and a molecular weight of 248.29 g/mol. Its IUPAC name is 8,9-dimethyl-1,3,4,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,8,10,12,14,16-octaene.
| Compound Name | 8,9-dimethyl-1,3,4,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,8,10,12,14,16-octaene |
|---|---|
| PubChem CID | 122523474 |
| Molecular Formula | C15H12N4 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 8,9-dimethyl-1,3,4,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,8,10,12,14,16-octaene |
| SMILES | Cc1c(C)c2nc3ccccc3n2c2nnccc12 |
| InChI | InChI=1S/C15H12N4/c1-9-10(2)14-17-12-5-3-4-6-13(12)19(14)15-11(9)7-8-16-18-15/h3-8H,1-2H3 |
| InChIKey | YVVAPZNGWULMNL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |