C12H16O3 — CID 10560301
[(1E)-1-[(1R,4S)-4-methyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]ethyl] acetate (PubChem CID 10560301) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is [(1E)-1-[(1R,4S)-4-methyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]ethyl] acetate.
| Compound Name | [(1E)-1-[(1R,4S)-4-methyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]ethyl] acetate |
|---|---|
| PubChem CID | 10560301 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | [(1E)-1-[(1R,4S)-4-methyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]ethyl] acetate |
| SMILES | CC(=O)O/C(C)=C1/C(=O)[C@@]2(C)CC[C@@H]1C2 |
| InChI | InChI=1S/C12H16O3/c1-7(15-8(2)13)10-9-4-5-12(3,6-9)11(10)14/h9H,4-6H2,1-3H3/b10-7+/t9-,12+/m1/s1 |
| InChIKey | ZIBXSHHCMWGGEB-DTHKZTQTSA-N |
| XLogP | 2.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|