C14H22O2 — CID 10561003
(1S,4R)-6-[(E)-2-methoxyethenyl]-1,3,3-trimethylbicyclo[2.2.2]octan-2-one (PubChem CID 10561003) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1S,4R)-6-[(E)-2-methoxyethenyl]-1,3,3-trimethylbicyclo[2.2.2]octan-2-one.
| Compound Name | (1S,4R)-6-[(E)-2-methoxyethenyl]-1,3,3-trimethylbicyclo[2.2.2]octan-2-one |
|---|---|
| PubChem CID | 10561003 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1S,4R)-6-[(E)-2-methoxyethenyl]-1,3,3-trimethylbicyclo[2.2.2]octan-2-one |
| SMILES | CO/C=C/C1C[C@H]2CC[C@]1(C)C(=O)C2(C)C |
| InChI | InChI=1S/C14H22O2/c1-13(2)10-5-7-14(3,12(13)15)11(9-10)6-8-16-4/h6,8,10-11H,5,7,9H2,1-4H3/b8-6+/t10-,11?,14+/m1/s1 |
| InChIKey | KMNONDLXXKIVPK-FKGUJTNBSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|