C20H32O3 — CID 70570700
1,3,3-trimethyl-6-[2-(oxan-2-yloxy)but-3-en-2-yl]bicyclo[2.2.2]octan-2-one (PubChem CID 70570700) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 1,3,3-trimethyl-6-[2-(oxan-2-yloxy)but-3-en-2-yl]bicyclo[2.2.2]octan-2-one.
| Compound Name | 1,3,3-trimethyl-6-[2-(oxan-2-yloxy)but-3-en-2-yl]bicyclo[2.2.2]octan-2-one |
|---|---|
| PubChem CID | 70570700 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 1,3,3-trimethyl-6-[2-(oxan-2-yloxy)but-3-en-2-yl]bicyclo[2.2.2]octan-2-one |
| SMILES | C=CC(C)(OC1CCCCO1)C1CC2CCC1(C)C(=O)C2(C)C |
| InChI | InChI=1S/C20H32O3/c1-6-20(5,23-16-9-7-8-12-22-16)15-13-14-10-11-19(15,4)17(21)18(14,2)3/h6,14-16H,1,7-13H2,2-5H3 |
| InChIKey | OFUOVNCAJNQLLV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|