C17H22F6O3 — CID 23405467
1-ethenyl-4-[1,1,1,3,3,3-hexafluoro-2-(oxan-2-yloxy)propan-2-yl]-2-oxabicyclo[2.2.2]octane (PubChem CID 23405467) has the molecular formula C17H22F6O3 and a molecular weight of 388.35 g/mol. Its IUPAC name is 1-ethenyl-4-[1,1,1,3,3,3-hexafluoro-2-(oxan-2-yloxy)propan-2-yl]-2-oxabicyclo[2.2.2]octane.
| Compound Name | 1-ethenyl-4-[1,1,1,3,3,3-hexafluoro-2-(oxan-2-yloxy)propan-2-yl]-2-oxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 23405467 |
| Molecular Formula | C17H22F6O3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-ethenyl-4-[1,1,1,3,3,3-hexafluoro-2-(oxan-2-yloxy)propan-2-yl]-2-oxabicyclo[2.2.2]octane |
| SMILES | C=CC12CCC(C(OC3CCCCO3)(C(F)(F)F)C(F)(F)F)(CC1)CO2 |
| InChI | InChI=1S/C17H22F6O3/c1-2-14-8-6-13(7-9-14,11-25-14)15(16(18,19)20,17(21,22)23)26-12-5-3-4-10-24-12/h2,12H,1,3-11H2 |
| InChIKey | YUPIVTOOGGUAGV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|