C9H12O5 — CID 14978498
5-[(E)-2-methoxyethenyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 14978498) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is 5-[(E)-2-methoxyethenyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(E)-2-methoxyethenyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 14978498 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 5-[(E)-2-methoxyethenyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CO/C=C/C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C9H12O5/c1-9(2)13-7(10)6(4-5-12-3)8(11)14-9/h4-6H,1-3H3/b5-4+ |
| InChIKey | UZGZERXRTRNMDC-SNAWJCMRSA-N |
| XLogP | 0.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|