C12H18O5 — CID 10562119
(Z)-4-methoxy-2-(1-methoxycyclohexyl)-4-oxobut-2-enoic acid (PubChem CID 10562119) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (Z)-4-methoxy-2-(1-methoxycyclohexyl)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-methoxy-2-(1-methoxycyclohexyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 10562119 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (Z)-4-methoxy-2-(1-methoxycyclohexyl)-4-oxobut-2-enoic acid |
| SMILES | COC(=O)/C=C(\C(=O)O)C1(OC)CCCCC1 |
| InChI | InChI=1S/C12H18O5/c1-16-10(13)8-9(11(14)15)12(17-2)6-4-3-5-7-12/h8H,3-7H2,1-2H3,(H,14,15)/b9-8+ |
| InChIKey | YDSAGZFUIXYPEZ-CMDGGOBGSA-N |
| XLogP | 1.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|