C15H24O4 — CID 10563839
[(2R)-2-[(1S,2S,5S)-2-acetyloxy-5-methylcyclohept-3-en-1-yl]propyl] acetate (PubChem CID 10563839) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is [(2R)-2-[(1S,2S,5S)-2-acetyloxy-5-methylcyclohept-3-en-1-yl]propyl] acetate.
| Compound Name | [(2R)-2-[(1S,2S,5S)-2-acetyloxy-5-methylcyclohept-3-en-1-yl]propyl] acetate |
|---|---|
| PubChem CID | 10563839 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [(2R)-2-[(1S,2S,5S)-2-acetyloxy-5-methylcyclohept-3-en-1-yl]propyl] acetate |
| SMILES | CC(=O)OC[C@H](C)[C@@H]1CC[C@H](C)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H24O4/c1-10-5-7-14(11(2)9-18-12(3)16)15(8-6-10)19-13(4)17/h6,8,10-11,14-15H,5,7,9H2,1-4H3/t10-,11-,14-,15-/m0/s1 |
| InChIKey | HKJGELFYMUNVFY-GVARAGBVSA-N |
| XLogP | 2.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|