C19H30O6 — CID 101063936
[(2S)-2-[(1S,2S,4aR,8R)-1-acetyloxy-8-hydroxy-4a,8-dimethyl-5-oxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]propyl] acetate (PubChem CID 101063936) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is [(2S)-2-[(1S,2S,4aR,8R)-1-acetyloxy-8-hydroxy-4a,8-dimethyl-5-oxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]propyl] acetate.
| Compound Name | [(2S)-2-[(1S,2S,4aR,8R)-1-acetyloxy-8-hydroxy-4a,8-dimethyl-5-oxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]propyl] acetate |
|---|---|
| PubChem CID | 101063936 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | [(2S)-2-[(1S,2S,4aR,8R)-1-acetyloxy-8-hydroxy-4a,8-dimethyl-5-oxo-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]propyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)[C@@H]1CC[C@@]2(C)C(=O)CC[C@@](C)(O)C2C1OC(C)=O |
| InChI | InChI=1S/C19H30O6/c1-11(10-24-12(2)20)14-6-8-18(4)15(22)7-9-19(5,23)17(18)16(14)25-13(3)21/h11,14,16-17,23H,6-10H2,1-5H3/t11-,14+,16?,17?,18+,19-/m1/s1 |
| InChIKey | ULBVOOMTMRNMQU-PQJGJYHDSA-N |
| XLogP | 2.26 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |