C15H26O5 — CID 102271409
(4S,5R,6R,8aR)-6-[(2S)-1,2-dihydroxypropan-2-yl]-4,5-dihydroxy-4,8a-dimethyl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 102271409) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (4S,5R,6R,8aR)-6-[(2S)-1,2-dihydroxypropan-2-yl]-4,5-dihydroxy-4,8a-dimethyl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4S,5R,6R,8aR)-6-[(2S)-1,2-dihydroxypropan-2-yl]-4,5-dihydroxy-4,8a-dimethyl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 102271409 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (4S,5R,6R,8aR)-6-[(2S)-1,2-dihydroxypropan-2-yl]-4,5-dihydroxy-4,8a-dimethyl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | C[C@]1(O)CCC(=O)[C@]2(C)CC[C@@H]([C@](C)(O)CO)C(O)C12 |
| InChI | InChI=1S/C15H26O5/c1-13-6-4-9(15(3,20)8-16)11(18)12(13)14(2,19)7-5-10(13)17/h9,11-12,16,18-20H,4-8H2,1-3H3/t9-,11?,12?,13+,14+,15-/m1/s1 |
| InChIKey | QZYZFAZWMGNMSD-HOGKHYBYSA-N |
| XLogP | 0.24 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |