C15H26O4 — CID 42620236
(4S,6R,7S,8aR)-4,5,7-trihydroxy-4,8a-dimethyl-6-propan-2-yl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 42620236) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (4S,6R,7S,8aR)-4,5,7-trihydroxy-4,8a-dimethyl-6-propan-2-yl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4S,6R,7S,8aR)-4,5,7-trihydroxy-4,8a-dimethyl-6-propan-2-yl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 42620236 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (4S,6R,7S,8aR)-4,5,7-trihydroxy-4,8a-dimethyl-6-propan-2-yl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | CC(C)[C@H]1C(O)C2[C@@](C)(O)CCC(=O)[C@]2(C)C[C@@H]1O |
| InChI | InChI=1S/C15H26O4/c1-8(2)11-9(16)7-14(3)10(17)5-6-15(4,19)13(14)12(11)18/h8-9,11-13,16,18-19H,5-7H2,1-4H3/t9-,11+,12?,13?,14-,15-/m0/s1 |
| InChIKey | GRWCWGUSGQAFPW-PTUOEWKISA-N |
| XLogP | 1.12 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |