C17H28O5 — CID 44631233
[(1R,2R,3S,4aR,8S)-3,8-dihydroxy-4a,8-dimethyl-5-oxo-2-propan-2-yl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate (PubChem CID 44631233) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(1R,2R,3S,4aR,8S)-3,8-dihydroxy-4a,8-dimethyl-5-oxo-2-propan-2-yl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate.
| Compound Name | [(1R,2R,3S,4aR,8S)-3,8-dihydroxy-4a,8-dimethyl-5-oxo-2-propan-2-yl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 44631233 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(1R,2R,3S,4aR,8S)-3,8-dihydroxy-4a,8-dimethyl-5-oxo-2-propan-2-yl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate |
| SMILES | CC(=O)OC1C2[C@@](C)(O)CCC(=O)[C@]2(C)C[C@H](O)[C@H]1C(C)C |
| InChI | InChI=1S/C17H28O5/c1-9(2)13-11(19)8-16(4)12(20)6-7-17(5,21)15(16)14(13)22-10(3)18/h9,11,13-15,19,21H,6-8H2,1-5H3/t11-,13+,14?,15?,16-,17-/m0/s1 |
| InChIKey | WENAAUBRGAPTCN-CZNKIITFSA-N |
| XLogP | 1.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |