C15H24O5S — CID 146034632
(3S,5S,9R,12R)-12-(2-hydroxypropan-2-yl)-5,9-dimethyl-3-oxo-2,4-dioxa-3λ4-thiatricyclo[7.3.1.05,13]tridecan-8-one (PubChem CID 146034632) has the molecular formula C15H24O5S and a molecular weight of 316.42 g/mol. Its IUPAC name is (3S,5S,9R,12R)-12-(2-hydroxypropan-2-yl)-5,9-dimethyl-3-oxo-2,4-dioxa-3λ4-thiatricyclo[7.3.1.05,13]tridecan-8-one.
| Compound Name | (3S,5S,9R,12R)-12-(2-hydroxypropan-2-yl)-5,9-dimethyl-3-oxo-2,4-dioxa-3λ4-thiatricyclo[7.3.1.05,13]tridecan-8-one |
|---|---|
| PubChem CID | 146034632 |
| Molecular Formula | C15H24O5S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (3S,5S,9R,12R)-12-(2-hydroxypropan-2-yl)-5,9-dimethyl-3-oxo-2,4-dioxa-3λ4-thiatricyclo[7.3.1.05,13]tridecan-8-one |
| SMILES | CC(C)(O)[C@@H]1CC[C@@]2(C)C(=O)CC[C@]3(C)O[S@@](=O)OC1C23 |
| InChI | InChI=1S/C15H24O5S/c1-13(2,17)9-5-7-14(3)10(16)6-8-15(4)12(14)11(9)19-21(18)20-15/h9,11-12,17H,5-8H2,1-4H3/t9-,11?,12?,14+,15+,21+/m1/s1 |
| InChIKey | SAXYOAXJMXUMCG-ABYZMWMUSA-N |
| XLogP | 1.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |