About [(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate
[(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate (PubChem CID 56600227) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is [(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate.
Analyze [(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate?
The IUPAC name of [(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate (CID 56600227) is [(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate.
What is the SMILES notation for [(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate?
The canonical SMILES for [(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate is CC(=O)OC[C@@H](C)[C@H]1C=CC(C)=CC1.
What is the InChIKey of [(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate?
The InChIKey is QOVUYFWYRHLIFF-PWSUYJOCSA-N. The full InChI is InChI=1S/C12H18O2/c1-9-4-6-12(7-5-9)10(2)8-14-11(3)13/h4-6,10,12H,7-8H2,1-3H3/t10-,12+/m1/s1.
What are the key properties of [(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate?
[(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate has a molecular weight of 194.27 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-[(1R)-4-methylcyclohexa-2,4-dien-1-yl]propyl] acetate is sourced from PubChem (CID 56600227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).