C20H35NO — CID 10566524
(1R,2S,5R)-2-[2-[(3aS,5R,7aR)-5-ethyl-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol (PubChem CID 10566524) has the molecular formula C20H35NO and a molecular weight of 305.51 g/mol. Its IUPAC name is (1R,2S,5R)-2-[2-[(3aS,5R,7aR)-5-ethyl-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-2-[2-[(3aS,5R,7aR)-5-ethyl-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10566524 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | (1R,2S,5R)-2-[2-[(3aS,5R,7aR)-5-ethyl-1,3,3a,4,5,7a-hexahydroisoindol-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
| SMILES | CC[C@H]1C=C[C@H]2CN(C(C)(C)[C@@H]3CC[C@@H](C)C[C@H]3O)C[C@H]2C1 |
| InChI | InChI=1S/C20H35NO/c1-5-15-7-8-16-12-21(13-17(16)11-15)20(3,4)18-9-6-14(2)10-19(18)22/h7-8,14-19,22H,5-6,9-13H2,1-4H3/t14-,15+,16+,17-,18-,19-/m1/s1 |
| InChIKey | OWIWZDJHPOJJLZ-PXRSPZQOSA-N |
| XLogP | 4.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|