C20H37NO2 — CID 11427289
(3S,6Z)-1-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-3-propan-2-yl-2,4,5,8-tetrahydroazocin-3-ol (PubChem CID 11427289) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is (3S,6Z)-1-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-3-propan-2-yl-2,4,5,8-tetrahydroazocin-3-ol.
| Compound Name | (3S,6Z)-1-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-3-propan-2-yl-2,4,5,8-tetrahydroazocin-3-ol |
|---|---|
| PubChem CID | 11427289 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | (3S,6Z)-1-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-3-propan-2-yl-2,4,5,8-tetrahydroazocin-3-ol |
| SMILES | CC(C)[C@@]1(O)CC/C=C\CN(C(C)(C)[C@@H]2CC[C@@H](C)C[C@H]2O)C1 |
| InChI | InChI=1S/C20H37NO2/c1-15(2)20(23)11-7-6-8-12-21(14-20)19(4,5)17-10-9-16(3)13-18(17)22/h6,8,15-18,22-23H,7,9-14H2,1-5H3/b8-6-/t16-,17-,18-,20-/m1/s1 |
| InChIKey | HDSLBTZXUYLWQF-OAKDVLGCSA-N |
| XLogP | 3.60 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|