C20H35NO2 — CID 11151397
(3S,6R,8R,10S,11S,14Z)-2,2,6-trimethyl-11-propan-2-yl-9-oxa-1-azatricyclo[8.6.0.03,8]hexadec-14-en-11-ol (PubChem CID 11151397) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is (3S,6R,8R,10S,11S,14Z)-2,2,6-trimethyl-11-propan-2-yl-9-oxa-1-azatricyclo[8.6.0.03,8]hexadec-14-en-11-ol.
| Compound Name | (3S,6R,8R,10S,11S,14Z)-2,2,6-trimethyl-11-propan-2-yl-9-oxa-1-azatricyclo[8.6.0.03,8]hexadec-14-en-11-ol |
|---|---|
| PubChem CID | 11151397 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | (3S,6R,8R,10S,11S,14Z)-2,2,6-trimethyl-11-propan-2-yl-9-oxa-1-azatricyclo[8.6.0.03,8]hexadec-14-en-11-ol |
| SMILES | CC(C)[C@@]1(O)CC/C=C\CN2[C@H]1O[C@@H]1C[C@H](C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C20H35NO2/c1-14(2)20(22)11-7-6-8-12-21-18(20)23-17-13-15(3)9-10-16(17)19(21,4)5/h6,8,14-18,22H,7,9-13H2,1-5H3/b8-6-/t15-,16-,17-,18+,20+/m1/s1 |
| InChIKey | CQMXUQVPLAQMPL-YEUBLOEWSA-N |
| XLogP | 3.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|