C19H33NO — CID 11737875
(1R,2S,5R)-2-[2-[(5S)-2-azaspiro[4.5]dec-6-en-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol (PubChem CID 11737875) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is (1R,2S,5R)-2-[2-[(5S)-2-azaspiro[4.5]dec-6-en-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-2-[2-[(5S)-2-azaspiro[4.5]dec-6-en-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11737875 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (1R,2S,5R)-2-[2-[(5S)-2-azaspiro[4.5]dec-6-en-2-yl]propan-2-yl]-5-methylcyclohexan-1-ol |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)N2CC[C@@]3(C=CCCC3)C2)[C@H](O)C1 |
| InChI | InChI=1S/C19H33NO/c1-15-7-8-16(17(21)13-15)18(2,3)20-12-11-19(14-20)9-5-4-6-10-19/h5,9,15-17,21H,4,6-8,10-14H2,1-3H3/t15-,16-,17-,19+/m1/s1 |
| InChIKey | VWOMPSHAYOVSCY-MTNOOBJLSA-N |
| XLogP | 3.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|