C22H24N2 — CID 10567444
6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline (PubChem CID 10567444) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline.
| Compound Name | 6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 10567444 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinoline |
| SMILES | CC(C)(C)c1ccc(C2=Cc3ccccc3C3=NCCCN23)cc1 |
| InChI | InChI=1S/C22H24N2/c1-22(2,3)18-11-9-16(10-12-18)20-15-17-7-4-5-8-19(17)21-23-13-6-14-24(20)21/h4-5,7-12,15H,6,13-14H2,1-3H3 |
| InChIKey | QFUQUZHTOIJKGG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|