C13H9N3O5S — CID 10567625
7-benzamido-2,1,3-benzoxadiazole-4-sulfonic acid (PubChem CID 10567625) has the molecular formula C13H9N3O5S and a molecular weight of 319.30 g/mol. Its IUPAC name is 7-benzamido-2,1,3-benzoxadiazole-4-sulfonic acid.
| Compound Name | 7-benzamido-2,1,3-benzoxadiazole-4-sulfonic acid |
|---|---|
| PubChem CID | 10567625 |
| Molecular Formula | C13H9N3O5S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 7-benzamido-2,1,3-benzoxadiazole-4-sulfonic acid |
| SMILES | O=C(Nc1ccc(S(=O)(=O)O)c2nonc12)c1ccccc1 |
| InChI | InChI=1S/C13H9N3O5S/c17-13(8-4-2-1-3-5-8)14-9-6-7-10(22(18,19)20)12-11(9)15-21-16-12/h1-7H,(H,14,17)(H,18,19,20) |
| InChIKey | ZGCJIWXGNOMQKB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|