C14H15Cl2F2NS — CID 10568991
2-[[(3aR,4R,7aS)-3,3-dichloro-2,2-difluoro-3a,4,5,6,7,7a-hexahydro-1H-inden-4-yl]sulfanyl]pyridine (PubChem CID 10568991) has the molecular formula C14H15Cl2F2NS and a molecular weight of 338.25 g/mol. Its IUPAC name is 2-[[(3aR,4R,7aS)-3,3-dichloro-2,2-difluoro-3a,4,5,6,7,7a-hexahydro-1H-inden-4-yl]sulfanyl]pyridine.
| Compound Name | 2-[[(3aR,4R,7aS)-3,3-dichloro-2,2-difluoro-3a,4,5,6,7,7a-hexahydro-1H-inden-4-yl]sulfanyl]pyridine |
|---|---|
| PubChem CID | 10568991 |
| Molecular Formula | C14H15Cl2F2NS |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2-[[(3aR,4R,7aS)-3,3-dichloro-2,2-difluoro-3a,4,5,6,7,7a-hexahydro-1H-inden-4-yl]sulfanyl]pyridine |
| SMILES | FC1(F)C[C@@H]2CCC[C@@H](Sc3ccccn3)[C@@H]2C1(Cl)Cl |
| InChI | InChI=1S/C14H15Cl2F2NS/c15-14(16)12-9(8-13(14,17)18)4-3-5-10(12)20-11-6-1-2-7-19-11/h1-2,6-7,9-10,12H,3-5,8H2/t9-,10+,12+/m0/s1 |
| InChIKey | MUEAJPLBWSPMNK-HOSYDEDBSA-N |
| XLogP | 5.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|