C13H8ClN3O5S — CID 10570082
2-[3-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid (PubChem CID 10570082) has the molecular formula C13H8ClN3O5S and a molecular weight of 353.74 g/mol. Its IUPAC name is 2-[3-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[3-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10570082 |
| Molecular Formula | C13H8ClN3O5S |
| Molecular Weight | 353.74 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 2-[3-[(5-chloro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=O)N(Cc2nc3cc(Cl)ccc3s2)C1=O |
| InChI | InChI=1S/C13H8ClN3O5S/c14-6-1-2-8-7(3-6)15-9(23-8)4-16-11(20)12(21)17(13(16)22)5-10(18)19/h1-3H,4-5H2,(H,18,19) |
| InChIKey | GHYVVUAWEAOHGR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.74 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|