C14H11N3O3S — CID 7998514
1-(1,3-benzothiazol-2-ylmethyl)-3-prop-2-enylimidazolidine-2,4,5-trione (PubChem CID 7998514) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-3-prop-2-enylimidazolidine-2,4,5-trione.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-prop-2-enylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7998514 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-prop-2-enylimidazolidine-2,4,5-trione |
| SMILES | C=CCN1C(=O)C(=O)N(Cc2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C14H11N3O3S/c1-2-7-16-12(18)13(19)17(14(16)20)8-11-15-9-5-3-4-6-10(9)21-11/h2-6H,1,7-8H2 |
| InChIKey | AXOQICVMQUGUJA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|