C13H10ClN3O4S — CID 10783309
2-[3-[(4-chloro-1,3-benzothiazol-2-yl)methyl]-2,4-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 10783309) has the molecular formula C13H10ClN3O4S and a molecular weight of 339.76 g/mol. Its IUPAC name is 2-[3-[(4-chloro-1,3-benzothiazol-2-yl)methyl]-2,4-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[3-[(4-chloro-1,3-benzothiazol-2-yl)methyl]-2,4-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10783309 |
| Molecular Formula | C13H10ClN3O4S |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-[3-[(4-chloro-1,3-benzothiazol-2-yl)methyl]-2,4-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CC(=O)N(Cc2nc3c(Cl)cccc3s2)C1=O |
| InChI | InChI=1S/C13H10ClN3O4S/c14-7-2-1-3-8-12(7)15-9(22-8)4-17-10(18)5-16(13(17)21)6-11(19)20/h1-3H,4-6H2,(H,19,20) |
| InChIKey | GRTKVYMVNMSUQV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|