C21H26N2O3 — CID 10570130
(2R,3S,5R)-5-[(6aR,10aR)-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 10570130) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2R,3S,5R)-5-[(6aR,10aR)-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-[(6aR,10aR)-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 10570130 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (2R,3S,5R)-5-[(6aR,10aR)-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CC1=C[C@@H]2c3cccc4c3c(cn4[C@H]3C[C@H](O)[C@@H](CO)O3)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C21H26N2O3/c1-12-6-15-14-4-3-5-16-21(14)13(7-17(15)22(2)9-12)10-23(16)20-8-18(25)19(11-24)26-20/h3-6,10,15,17-20,24-25H,7-9,11H2,1-2H3/t15-,17-,18+,19-,20-/m1/s1 |
| InChIKey | IGWFAIZPBKFRNK-XIKSMUEASA-N |
| XLogP | 2.18 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|