C23H30N2O6 — CID 101008950
(2S,3R,4S,5R,6R)-2-[[(6aR,10aR)-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 101008950) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[[(6aR,10aR)-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[[(6aR,10aR)-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 101008950 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[[(6aR,10aR)-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC1=C[C@@H]2c3cccc4c3c(cn4CO[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C23H30N2O6/c1-12-6-15-14-4-3-5-16-19(14)13(7-17(15)24(2)8-12)9-25(16)11-30-23-22(29)21(28)20(27)18(10-26)31-23/h3-6,9,15,17-18,20-23,26-29H,7-8,10-11H2,1-2H3/t15-,17-,18-,20+,21+,22-,23-/m1/s1 |
| InChIKey | WCHSCMMBEKQUBQ-INZPHNOTSA-N |
| XLogP | 0.32 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|