C24H48O3 — CID 10572115
(E,4R,5R,6R,8R,9R,10R,12R,13R)-5,9,13-trimethoxy-4,6,8,10,12,14-hexamethylpentadec-2-ene (PubChem CID 10572115) has the molecular formula C24H48O3 and a molecular weight of 384.65 g/mol. Its IUPAC name is (E,4R,5R,6R,8R,9R,10R,12R,13R)-5,9,13-trimethoxy-4,6,8,10,12,14-hexamethylpentadec-2-ene.
| Compound Name | (E,4R,5R,6R,8R,9R,10R,12R,13R)-5,9,13-trimethoxy-4,6,8,10,12,14-hexamethylpentadec-2-ene |
|---|---|
| PubChem CID | 10572115 |
| Molecular Formula | C24H48O3 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.36 |
| IUPAC Name | (E,4R,5R,6R,8R,9R,10R,12R,13R)-5,9,13-trimethoxy-4,6,8,10,12,14-hexamethylpentadec-2-ene |
| SMILES | C/C=C/[C@@H](C)[C@H](OC)[C@H](C)C[C@@H](C)[C@H](OC)[C@H](C)C[C@@H](C)[C@H](OC)C(C)C |
| InChI | InChI=1S/C24H48O3/c1-12-13-17(4)23(26-10)19(6)15-21(8)24(27-11)20(7)14-18(5)22(25-9)16(2)3/h12-13,16-24H,14-15H2,1-11H3/b13-12+/t17-,18-,19-,20-,21-,22-,23+,24-/m1/s1 |
| InChIKey | SOKOUHPCZPIGMB-MKVAWZPXSA-N |
| XLogP | 6.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|