C21H24O7 — CID 10572339
1-(3,4-dimethoxyphenyl)-3-(2-hydroxy-4,6-dimethoxy-3-methylphenyl)-2-methylpropane-1,3-dione (PubChem CID 10572339) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(2-hydroxy-4,6-dimethoxy-3-methylphenyl)-2-methylpropane-1,3-dione.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(2-hydroxy-4,6-dimethoxy-3-methylphenyl)-2-methylpropane-1,3-dione |
|---|---|
| PubChem CID | 10572339 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(2-hydroxy-4,6-dimethoxy-3-methylphenyl)-2-methylpropane-1,3-dione |
| SMILES | COc1ccc(C(=O)C(C)C(=O)c2c(OC)cc(OC)c(C)c2O)cc1OC |
| InChI | InChI=1S/C21H24O7/c1-11-15(26-4)10-17(28-6)18(20(11)23)21(24)12(2)19(22)13-7-8-14(25-3)16(9-13)27-5/h7-10,12,23H,1-6H3 |
| InChIKey | DFDWDGCDLPIWJJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|