C18H23F2NO7 — CID 10573222
methyl 3,3-difluoro-4-(2-methoxyethoxymethoxy)-2-(phenylmethoxycarbonylamino)pent-4-enoate (PubChem CID 10573222) has the molecular formula C18H23F2NO7 and a molecular weight of 403.38 g/mol. Its IUPAC name is methyl 3,3-difluoro-4-(2-methoxyethoxymethoxy)-2-(phenylmethoxycarbonylamino)pent-4-enoate.
| Compound Name | methyl 3,3-difluoro-4-(2-methoxyethoxymethoxy)-2-(phenylmethoxycarbonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 10573222 |
| Molecular Formula | C18H23F2NO7 |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | methyl 3,3-difluoro-4-(2-methoxyethoxymethoxy)-2-(phenylmethoxycarbonylamino)pent-4-enoate |
| SMILES | C=C(OCOCCOC)C(F)(F)C(NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C18H23F2NO7/c1-13(28-12-26-10-9-24-2)18(19,20)15(16(22)25-3)21-17(23)27-11-14-7-5-4-6-8-14/h4-8,15H,1,9-12H2,2-3H3,(H,21,23) |
| InChIKey | ZUUCULDNSJSEEI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|