About 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium
2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium (PubChem CID 10573266) has the molecular formula C18H32O7Ti
and a molecular weight of 408.31 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium |
| PubChem CID | 10573266 |
| Molecular Formula | C18H32O7Ti |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium |
| SMILES | CC(C)O.CC(C)O.CC(C)O.COc1ccc(C(=O)C(=O)O)cc1.[Ti] |
| InChI | InChI=1S/C9H8O4.3C3H8O.Ti/c1-13-7-4-2-6(3-5-7)8(10)9(11)12;3*1-3(2)4;/h2-5H,1H3,(H,11,12);3*3-4H,1-2H3; |
| InChIKey | SQFLHIXMZGJBPU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium?
The IUPAC name of 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium (CID 10573266) is 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium.
What is the SMILES notation for 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium?
The canonical SMILES for 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium is CC(C)O.CC(C)O.CC(C)O.COc1ccc(C(=O)C(=O)O)cc1.[Ti].
What is the InChIKey of 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium?
The InChIKey is SQFLHIXMZGJBPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.3C3H8O.Ti/c1-13-7-4-2-6(3-5-7)8(10)9(11)12;3*1-3(2)4;/h2-5H,1H3,(H,11,12);3*3-4H,1-2H3;.
What are the key properties of 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium?
2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium has a molecular weight of 408.31 g/mol, XLogP of 2.12, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-2-oxoacetic acid;tris(propan-2-ol);titanium is sourced from PubChem (CID 10573266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).