C23H19NO4S — CID 10573347
3-(4-benzoylphenyl)-2-(4-hydroxy-3-methoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 10573347) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is 3-(4-benzoylphenyl)-2-(4-hydroxy-3-methoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-benzoylphenyl)-2-(4-hydroxy-3-methoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10573347 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3-(4-benzoylphenyl)-2-(4-hydroxy-3-methoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C2SCC(=O)N2c2ccc(C(=O)c3ccccc3)cc2)ccc1O |
| InChI | InChI=1S/C23H19NO4S/c1-28-20-13-17(9-12-19(20)25)23-24(21(26)14-29-23)18-10-7-16(8-11-18)22(27)15-5-3-2-4-6-15/h2-13,23,25H,14H2,1H3 |
| InChIKey | ZNNVJLBLXSOWKN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |