C28H23NOS — CID 10574205
6-(4-methylphenyl)sulfanyl-2,2-diphenyl-1,3-dihydroquinolin-4-one (PubChem CID 10574205) has the molecular formula C28H23NOS and a molecular weight of 421.57 g/mol. Its IUPAC name is 6-(4-methylphenyl)sulfanyl-2,2-diphenyl-1,3-dihydroquinolin-4-one.
| Compound Name | 6-(4-methylphenyl)sulfanyl-2,2-diphenyl-1,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 10574205 |
| Molecular Formula | C28H23NOS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 6-(4-methylphenyl)sulfanyl-2,2-diphenyl-1,3-dihydroquinolin-4-one |
| SMILES | Cc1ccc(Sc2ccc3c(c2)C(=O)CC(c2ccccc2)(c2ccccc2)N3)cc1 |
| InChI | InChI=1S/C28H23NOS/c1-20-12-14-23(15-13-20)31-24-16-17-26-25(18-24)27(30)19-28(29-26,21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-18,29H,19H2,1H3 |
| InChIKey | AYRXFOZRLXKZFR-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |