C40H24N2O4S2 — CID 21434743
5-[4-[4-(1,3-dioxo-2-phenylisoindol-5-yl)sulfanylphenyl]phenyl]sulfanyl-2-phenylisoindole-1,3-dione (PubChem CID 21434743) has the molecular formula C40H24N2O4S2 and a molecular weight of 660.78 g/mol. Its IUPAC name is 5-[4-[4-(1,3-dioxo-2-phenylisoindol-5-yl)sulfanylphenyl]phenyl]sulfanyl-2-phenylisoindole-1,3-dione.
| Compound Name | 5-[4-[4-(1,3-dioxo-2-phenylisoindol-5-yl)sulfanylphenyl]phenyl]sulfanyl-2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 21434743 |
| Molecular Formula | C40H24N2O4S2 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.12 |
| IUPAC Name | 5-[4-[4-(1,3-dioxo-2-phenylisoindol-5-yl)sulfanylphenyl]phenyl]sulfanyl-2-phenylisoindole-1,3-dione |
| SMILES | O=C1c2ccc(Sc3ccc(-c4ccc(Sc5ccc6c(c5)C(=O)N(c5ccccc5)C6=O)cc4)cc3)cc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C40H24N2O4S2/c43-37-33-21-19-31(23-35(33)39(45)41(37)27-7-3-1-4-8-27)47-29-15-11-25(12-16-29)26-13-17-30(18-14-26)48-32-20-22-34-36(24-32)40(46)42(38(34)44)28-9-5-2-6-10-28/h1-24H |
| InChIKey | IKTCNGYJJDDGCB-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|