C26H28O6 — CID 10574935
[(1S,6S,7R,8S,9R,11S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-6-yl] acetate (PubChem CID 10574935) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is [(1S,6S,7R,8S,9R,11S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-6-yl] acetate.
| Compound Name | [(1S,6S,7R,8S,9R,11S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 10574935 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | [(1S,6S,7R,8S,9R,11S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C2CO[C@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C26H28O6/c1-17(27)31-21-12-20-15-30-26-23(20)24(21)25(29-14-19-10-6-3-7-11-19)22(32-26)16-28-13-18-8-4-2-5-9-18/h2-12,21-26H,13-16H2,1H3/t21-,22+,23+,24-,25+,26-/m0/s1 |
| InChIKey | QOCIOZRTIGKVMR-FXSNZCSTSA-N |
| XLogP | 3.65 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|