C24H24O5 — CID 11794846
(1S,7S,8S,9R,11S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-6-one (PubChem CID 11794846) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is (1S,7S,8S,9R,11S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-6-one.
| Compound Name | (1S,7S,8S,9R,11S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-6-one |
|---|---|
| PubChem CID | 11794846 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (1S,7S,8S,9R,11S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-6-one |
| SMILES | O=C1C=C2CO[C@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C24H24O5/c25-19-11-18-14-28-24-21(18)22(19)23(27-13-17-9-5-2-6-10-17)20(29-24)15-26-12-16-7-3-1-4-8-16/h1-11,20-24H,12-15H2/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | RKJCQTRSKIORQW-SJSRKZJXSA-N |
| XLogP | 3.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |