C31H50O — CID 10575132
(2S,4aR)-5-[(3E,7E)-4,12-dimethyl-8-(1-tritioethenyl)trideca-3,7,11-trienyl]-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol (PubChem CID 10575132) has the molecular formula C31H50O and a molecular weight of 440.75 g/mol. Its IUPAC name is (2S,4aR)-5-[(3E,7E)-4,12-dimethyl-8-(1-tritioethenyl)trideca-3,7,11-trienyl]-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (2S,4aR)-5-[(3E,7E)-4,12-dimethyl-8-(1-tritioethenyl)trideca-3,7,11-trienyl]-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 10575132 |
| Molecular Formula | C31H50O |
| Molecular Weight | 440.75 g/mol |
| Exact Mass | 440.39 |
| IUPAC Name | (2S,4aR)-5-[(3E,7E)-4,12-dimethyl-8-(1-tritioethenyl)trideca-3,7,11-trienyl]-1,1,4a-trimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
| SMILES | [3H]C(=C)/C(=C/CC/C(C)=C/CCC1C(=C)CCC2C(C)(C)[C@@H](O)CC[C@]12C)CCC=C(C)C |
| InChI | InChI=1S/C31H50O/c1-9-26(16-10-13-23(2)3)17-11-14-24(4)15-12-18-27-25(5)19-20-28-30(6,7)29(32)21-22-31(27,28)8/h9,13,15,17,27-29,32H,1,5,10-12,14,16,18-22H2,2-4,6-8H3/b24-15+,26-17-/t27?,28?,29-,31+/m0/s1/i9T |
| InChIKey | XBBVHKGZCWAQFT-IAHQRDBCSA-N |
| XLogP | 9.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.75 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|