C22H22Cl2N2O4 — CID 10575476
ethyl 5-[[4-[bis(2-chloroethyl)amino]benzoyl]amino]-1-benzofuran-2-carboxylate (PubChem CID 10575476) has the molecular formula C22H22Cl2N2O4 and a molecular weight of 449.33 g/mol. Its IUPAC name is ethyl 5-[[4-[bis(2-chloroethyl)amino]benzoyl]amino]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[[4-[bis(2-chloroethyl)amino]benzoyl]amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 10575476 |
| Molecular Formula | C22H22Cl2N2O4 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | ethyl 5-[[4-[bis(2-chloroethyl)amino]benzoyl]amino]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)c3ccc(N(CCCl)CCCl)cc3)ccc2o1 |
| InChI | InChI=1S/C22H22Cl2N2O4/c1-2-29-22(28)20-14-16-13-17(5-8-19(16)30-20)25-21(27)15-3-6-18(7-4-15)26(11-9-23)12-10-24/h3-8,13-14H,2,9-12H2,1H3,(H,25,27) |
| InChIKey | BVRHGMYZWIOUCK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|