C24H39NO5Si — CID 10575509
benzyl (4S)-4-[(E,1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypent-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10575509) has the molecular formula C24H39NO5Si and a molecular weight of 449.66 g/mol. Its IUPAC name is benzyl (4S)-4-[(E,1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypent-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4S)-4-[(E,1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypent-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10575509 |
| Molecular Formula | C24H39NO5Si |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | benzyl (4S)-4-[(E,1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypent-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1COC(C)(C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H39NO5Si/c1-9-13-20(30-31(7,8)23(2,3)4)21(26)19-17-29-24(5,6)25(19)22(27)28-16-18-14-11-10-12-15-18/h9-15,19-21,26H,16-17H2,1-8H3/b13-9+/t19-,20+,21+/m0/s1 |
| InChIKey | YYDAVYOIZJOHND-TWAZDOIHSA-N |
| XLogP | 5.09 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|