C21H16ClF5N2O3 — CID 10576504
methyl 1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenylpyrazole-3-carboxylate (PubChem CID 10576504) has the molecular formula C21H16ClF5N2O3 and a molecular weight of 474.81 g/mol. Its IUPAC name is methyl 1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenylpyrazole-3-carboxylate.
| Compound Name | methyl 1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 10576504 |
| Molecular Formula | C21H16ClF5N2O3 |
| Molecular Weight | 474.81 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | methyl 1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)n(-c2ccc(Cl)c(COCC(F)(F)C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H16ClF5N2O3/c1-31-19(30)17-10-18(13-5-3-2-4-6-13)29(28-17)15-7-8-16(22)14(9-15)11-32-12-20(23,24)21(25,26)27/h2-10H,11-12H2,1H3 |
| InChIKey | OBIUFTLSYAFNCJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.81 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|