C20H15ClF5N3O2 — CID 10742605
1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenylpyrazole-3-carboxamide (PubChem CID 10742605) has the molecular formula C20H15ClF5N3O2 and a molecular weight of 459.80 g/mol. Its IUPAC name is 1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenylpyrazole-3-carboxamide.
| Compound Name | 1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 10742605 |
| Molecular Formula | C20H15ClF5N3O2 |
| Molecular Weight | 459.80 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 1-[4-chloro-3-(2,2,3,3,3-pentafluoropropoxymethyl)phenyl]-5-phenylpyrazole-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)n(-c2ccc(Cl)c(COCC(F)(F)C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H15ClF5N3O2/c21-15-7-6-14(8-13(15)10-31-11-19(22,23)20(24,25)26)29-17(9-16(28-29)18(27)30)12-4-2-1-3-5-12/h1-9H,10-11H2,(H2,27,30) |
| InChIKey | DGOIIKLWSGECIW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.80 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|